| Diisopropyl azodicarboxylate | |
|---|---|
 |
|
 |
|
| IUPAC name | Diisopropyl azodicarboxylate |
| Identifiers | |
| CAS number | [2446-83-5] |
| SMILES | O=C(OC(C)C)\N=N/C(OC(C)C)=O |
| Properties | |
| Molecular formula | C8H14N2O4 |
| Molar mass | 202. IUPAC Nomenclature is a system of naming Chemical compounds and of describing the science of Chemistry in general CAS registry numbers are unique numerical identifiers for Chemical compounds Polymers biological sequences mixtures and Alloys They are also referred to A chemical formula is a way of expressing information about the Atoms that constitute a particular Chemical compound, and how the relationship between those atoms changes Molar mass, symbol M, is the Mass of one mole of a substance ( Chemical element or Chemical compound) 21 g/mol |
| Density | 1. The density of a material is defined as its Mass per unit Volume: \rho = \frac{m}{V} Different materials usually have different 027 g/cm3 |
| Boiling point |
75°C/0. The boiling point of a liquid is the temperature at which the Vapor pressure of the liquid equals the environmental pressure surrounding the liquid 25 mm Hg |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
The chemical compound diisopropyl azodicarboxylate (DIAD) is the ester of azocarbonic acid. In Chemistry, the standard state of a material is its state at 1 bar (100 Kilopascals exactly A chemical compound is a substance consisting of two or more different elements chemically bonded together in a fixed proportion by Mass. Esters are a class of Chemical compounds and Functional groups Esters consist of an inorganic or organic Acid in which at least It is used as a reagent in the production of many organic compounds. A reagent or reactant is a substance or compound consumed during a Chemical reaction. An organic compound is any member of a large class of Chemical compounds whose Molecules contain Carbon. Its main use is in the Mitsunobu reaction, where it serves as an oxidant. The Mitsunobu reaction is an Organic reaction that converts an Alcohol into a variety of functional groups such as an Ester, using Triphenylphosphine Redox (shorthand for reduction-oxidation reaction describes all Chemical reactions in which atoms have their Oxidation number ( Oxidation state
It is sometimes preferred to diethyl azodicarboxylate (DEAD) because it is more hindered, and thus will not form hydrazide byproducts. Diethyl azodicarboxylate, often abbreviated DEAD is the Organic compound CH3CH2O2CN=NCO2CH2CH3
References
Dapyx Software network: MP3 Explorer | Ebook Manager | Zenithic